About ethyl 7-methyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate
ethyl 7-methyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate (PubChem CID 126500883) has the molecular formula C12H15NO3
and a molecular weight of 221.26 g/mol. Its IUPAC name is ethyl 7-methyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-methyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate |
| PubChem CID | 126500883 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | ethyl 7-methyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate |
| SMILES | CCOC(=O)C1CCc2cc(C)cc(=O)n21 |
| InChI | InChI=1S/C12H15NO3/c1-3-16-12(15)10-5-4-9-6-8(2)7-11(14)13(9)10/h6-7,10H,3-5H2,1-2H3 |
| InChIKey | FPERBZGTPGDEIP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 7-methyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-methyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate?
The IUPAC name of ethyl 7-methyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate (CID 126500883) is ethyl 7-methyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate.
What is the SMILES notation for ethyl 7-methyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate?
The canonical SMILES for ethyl 7-methyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate is CCOC(=O)C1CCc2cc(C)cc(=O)n21.
What is the InChIKey of ethyl 7-methyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate?
The InChIKey is FPERBZGTPGDEIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO3/c1-3-16-12(15)10-5-4-9-6-8(2)7-11(14)13(9)10/h6-7,10H,3-5H2,1-2H3.
What are the key properties of ethyl 7-methyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate?
ethyl 7-methyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate has a molecular weight of 221.26 g/mol, XLogP of 1.21, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-methyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate is sourced from PubChem (CID 126500883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).