C13H21N7O4 — CID 126501354
[(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-8-prop-2-enyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate (PubChem CID 126501354) has the molecular formula C13H21N7O4 and a molecular weight of 339.36 g/mol. Its IUPAC name is [(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-8-prop-2-enyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate.
| Compound Name | [(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-8-prop-2-enyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate |
|---|---|
| PubChem CID | 126501354 |
| Molecular Formula | C13H21N7O4 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | [(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-8-prop-2-enyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate |
| SMILES | C=CCC1CC(O)(O)[C@]23NC(N)=N[C@H]2[C@H](COC(N)=O)N=C(N)N13 |
| InChI | InChI=1S/C13H21N7O4/c1-2-3-6-4-12(22,23)13-8(18-9(14)19-13)7(5-24-11(16)21)17-10(15)20(6)13/h2,6-8,22-23H,1,3-5H2,(H2,15,17)(H2,16,21)(H3,14,18,19)/t6?,7-,8-,13-/m0/s1 |
| InChIKey | YOGZCNQQGJRMAZ-MBDSQHPFSA-N |
| XLogP | -2.91 |
| TPSA | 184.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|