C14H24N6O5 — CID 126501371
[(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,2-dimethylpropanoate (PubChem CID 126501371) has the molecular formula C14H24N6O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,2-dimethylpropanoate.
| Compound Name | [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 126501371 |
| Molecular Formula | C14H24N6O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@H]1CN2C(N)=N[C@@H](CO)[C@@H]3N=C(N)N[C@@]32C1(O)O |
| InChI | InChI=1S/C14H24N6O5/c1-12(2,3)9(22)25-7-4-20-11(16)17-6(5-21)8-13(20,14(7,23)24)19-10(15)18-8/h6-8,21,23-24H,4-5H2,1-3H3,(H2,16,17)(H3,15,18,19)/t6-,7-,8-,13-/m0/s1 |
| InChIKey | RERDHDNVRNEZHR-NDPIOBCDSA-N |
| XLogP | -3.39 |
| TPSA | 179.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | -3.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|