C17H19F3N6O5 — CID 126501374
[(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2-(trifluoromethyl)benzoate (PubChem CID 126501374) has the molecular formula C17H19F3N6O5 and a molecular weight of 444.37 g/mol. Its IUPAC name is [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2-(trifluoromethyl)benzoate.
| Compound Name | [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 126501374 |
| Molecular Formula | C17H19F3N6O5 |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2-(trifluoromethyl)benzoate |
| SMILES | NC1=N[C@H]2[C@H](CO)N=C(N)N3C[C@H](OC(=O)c4ccccc4C(F)(F)F)C(O)(O)[C@]23N1 |
| InChI | InChI=1S/C17H19F3N6O5/c18-17(19,20)8-4-2-1-3-7(8)12(28)31-10-5-26-14(22)23-9(6-27)11-15(26,16(10,29)30)25-13(21)24-11/h1-4,9-11,27,29-30H,5-6H2,(H2,22,23)(H3,21,24,25)/t9-,10-,11-,15-/m0/s1 |
| InChIKey | JASALYCADJWQID-VEABSNGSSA-N |
| XLogP | -2.10 |
| TPSA | 179.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|