C20H25F3N6O4 — CID 126501402
[(3aS,4S,8S,9S,10aS)-2,6-diamino-4-ethyl-10,10-dihydroxy-8-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2-methyl-5-(trifluoromethyl)benzoate (PubChem CID 126501402) has the molecular formula C20H25F3N6O4 and a molecular weight of 470.45 g/mol. Its IUPAC name is [(3aS,4S,8S,9S,10aS)-2,6-diamino-4-ethyl-10,10-dihydroxy-8-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2-methyl-5-(trifluoromethyl)benzoate.
| Compound Name | [(3aS,4S,8S,9S,10aS)-2,6-diamino-4-ethyl-10,10-dihydroxy-8-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2-methyl-5-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 126501402 |
| Molecular Formula | C20H25F3N6O4 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | [(3aS,4S,8S,9S,10aS)-2,6-diamino-4-ethyl-10,10-dihydroxy-8-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2-methyl-5-(trifluoromethyl)benzoate |
| SMILES | CC[C@@H]1N=C(N)N2[C@@H](C)[C@H](OC(=O)c3cc(C(F)(F)F)ccc3C)C(O)(O)[C@@]23NC(N)=N[C@@H]13 |
| InChI | InChI=1S/C20H25F3N6O4/c1-4-12-13-18(28-16(24)27-13)19(31,32)14(9(3)29(18)17(25)26-12)33-15(30)11-7-10(20(21,22)23)6-5-8(11)2/h5-7,9,12-14,31-32H,4H2,1-3H3,(H2,25,26)(H3,24,27,28)/t9-,12-,13-,14-,18-/m0/s1 |
| InChIKey | MJDGJFNZBPPNII-RQAVHYDGSA-N |
| XLogP | 0.01 |
| TPSA | 158.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|