C23H23F3N6O5 — CID 126501410
[(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 4-[2-(trifluoromethyl)phenyl]benzoate (PubChem CID 126501410) has the molecular formula C23H23F3N6O5 and a molecular weight of 520.47 g/mol. Its IUPAC name is [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 4-[2-(trifluoromethyl)phenyl]benzoate.
| Compound Name | [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 4-[2-(trifluoromethyl)phenyl]benzoate |
|---|---|
| PubChem CID | 126501410 |
| Molecular Formula | C23H23F3N6O5 |
| Molecular Weight | 520.47 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 4-[2-(trifluoromethyl)phenyl]benzoate |
| SMILES | NC1=N[C@H]2[C@H](CO)N=C(N)N3C[C@H](OC(=O)c4ccc(-c5ccccc5C(F)(F)F)cc4)C(O)(O)[C@]23N1 |
| InChI | InChI=1S/C23H23F3N6O5/c24-23(25,26)14-4-2-1-3-13(14)11-5-7-12(8-6-11)18(34)37-16-9-32-20(28)29-15(10-33)17-21(32,22(16,35)36)31-19(27)30-17/h1-8,15-17,33,35-36H,9-10H2,(H2,28,29)(H3,27,30,31)/t15-,16-,17-,21-/m0/s1 |
| InChIKey | JUXZMVUJYJEHLC-IAGYGMIVSA-N |
| XLogP | -0.43 |
| TPSA | 179.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.47 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|