C19H23F3N6O5 — CID 126501429
[(3aS,4R,8S,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-8-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2-methyl-5-(trifluoromethyl)benzoate (PubChem CID 126501429) has the molecular formula C19H23F3N6O5 and a molecular weight of 472.42 g/mol. Its IUPAC name is [(3aS,4R,8S,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-8-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2-methyl-5-(trifluoromethyl)benzoate.
| Compound Name | [(3aS,4R,8S,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-8-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2-methyl-5-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 126501429 |
| Molecular Formula | C19H23F3N6O5 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | [(3aS,4R,8S,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-8-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2-methyl-5-(trifluoromethyl)benzoate |
| SMILES | Cc1ccc(C(F)(F)F)cc1C(=O)O[C@H]1[C@H](C)N2C(N)=N[C@@H](CO)[C@@H]3N=C(N)N[C@@]32C1(O)O |
| InChI | InChI=1S/C19H23F3N6O5/c1-7-3-4-9(19(20,21)22)5-10(7)14(30)33-13-8(2)28-16(24)25-11(6-29)12-17(28,18(13,31)32)27-15(23)26-12/h3-5,8,11-13,29,31-32H,6H2,1-2H3,(H2,24,25)(H3,23,26,27)/t8-,11-,12-,13-,17-/m0/s1 |
| InChIKey | CAYBMCZDXFXGEH-FTIWDDHFSA-N |
| XLogP | -1.40 |
| TPSA | 179.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|