C32H30ClN5O2 — CID 126501547
2-[(3-chloroquinolin-6-yl)methyl]-N-[[2-methyl-6-(2-phenylmethoxyethylamino)-3-pyridinyl]methyl]pyridine-4-carboxamide (PubChem CID 126501547) has the molecular formula C32H30ClN5O2 and a molecular weight of 552.08 g/mol. Its IUPAC name is 2-[(3-chloroquinolin-6-yl)methyl]-N-[[2-methyl-6-(2-phenylmethoxyethylamino)-3-pyridinyl]methyl]pyridine-4-carboxamide.
| Compound Name | 2-[(3-chloroquinolin-6-yl)methyl]-N-[[2-methyl-6-(2-phenylmethoxyethylamino)-3-pyridinyl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 126501547 |
| Molecular Formula | C32H30ClN5O2 |
| Molecular Weight | 552.08 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | 2-[(3-chloroquinolin-6-yl)methyl]-N-[[2-methyl-6-(2-phenylmethoxyethylamino)-3-pyridinyl]methyl]pyridine-4-carboxamide |
| SMILES | Cc1nc(NCCOCc2ccccc2)ccc1CNC(=O)c1ccnc(Cc2ccc3ncc(Cl)cc3c2)c1 |
| InChI | InChI=1S/C32H30ClN5O2/c1-22-26(8-10-31(38-22)35-13-14-40-21-23-5-3-2-4-6-23)19-37-32(39)25-11-12-34-29(18-25)16-24-7-9-30-27(15-24)17-28(33)20-36-30/h2-12,15,17-18,20H,13-14,16,19,21H2,1H3,(H,35,38)(H,37,39) |
| InChIKey | TVQDFHXJDCKTEJ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.08 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|