C10H18FNO2 — CID 126501551
(6R,7R,8S)-8-(2-fluoropropyl)-4-azaspiro[2.5]octane-6,7-diol (PubChem CID 126501551) has the molecular formula C10H18FNO2 and a molecular weight of 203.26 g/mol. Its IUPAC name is (6R,7R,8S)-8-(2-fluoropropyl)-4-azaspiro[2.5]octane-6,7-diol.
| Compound Name | (6R,7R,8S)-8-(2-fluoropropyl)-4-azaspiro[2.5]octane-6,7-diol |
|---|---|
| PubChem CID | 126501551 |
| Molecular Formula | C10H18FNO2 |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (6R,7R,8S)-8-(2-fluoropropyl)-4-azaspiro[2.5]octane-6,7-diol |
| SMILES | CC(F)C[C@@H]1[C@@H](O)[C@H](O)CNC12CC2 |
| InChI | InChI=1S/C10H18FNO2/c1-6(11)4-7-9(14)8(13)5-12-10(7)2-3-10/h6-9,12-14H,2-5H2,1H3/t6?,7-,8-,9-/m1/s1 |
| InChIKey | DLAUAABNRCDMDT-FUZJYRNYSA-N |
| XLogP | 0.21 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |