C31H37FN2O — CID 126502158
(1S,2R,5S,6R,14S,16R)-N-(2-fluoroethyl)-5-isoquinolin-7-yl-N,6-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-amine (PubChem CID 126502158) has the molecular formula C31H37FN2O and a molecular weight of 472.65 g/mol. Its IUPAC name is (1S,2R,5S,6R,14S,16R)-N-(2-fluoroethyl)-5-isoquinolin-7-yl-N,6-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-amine.
| Compound Name | (1S,2R,5S,6R,14S,16R)-N-(2-fluoroethyl)-5-isoquinolin-7-yl-N,6-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-amine |
|---|---|
| PubChem CID | 126502158 |
| Molecular Formula | C31H37FN2O |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | (1S,2R,5S,6R,14S,16R)-N-(2-fluoroethyl)-5-isoquinolin-7-yl-N,6-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-amine |
| SMILES | CN(CCF)[C@H]1CCC2=CC3=CC[C@]4(C)[C@@H](c5ccc6ccncc6c5)CC[C@H]4[C@@]34CC[C@]2(C1)O4 |
| InChI | InChI=1S/C31H37FN2O/c1-29-11-9-25-18-24-5-6-26(34(2)16-14-32)19-30(24)12-13-31(25,35-30)28(29)8-7-27(29)22-4-3-21-10-15-33-20-23(21)17-22/h3-4,9-10,15,17-18,20,26-28H,5-8,11-14,16,19H2,1-2H3/t26-,27+,28+,29+,30+,31+/m0/s1 |
| InChIKey | NLCBNUHMFPPHSH-GUBSCVCPSA-N |
| XLogP | 6.75 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |