About 3-(2,5-dimethylpyrrol-1-yl)-1,2-benzoxazol-7-amine
3-(2,5-dimethylpyrrol-1-yl)-1,2-benzoxazol-7-amine (PubChem CID 126502324) has the molecular formula C13H13N3O
and a molecular weight of 227.27 g/mol. Its IUPAC name is 3-(2,5-dimethylpyrrol-1-yl)-1,2-benzoxazol-7-amine.
Molecular Properties
| Compound Name | 3-(2,5-dimethylpyrrol-1-yl)-1,2-benzoxazol-7-amine |
| PubChem CID | 126502324 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 3-(2,5-dimethylpyrrol-1-yl)-1,2-benzoxazol-7-amine |
| SMILES | Cc1ccc(C)n1-c1noc2c(N)cccc12 |
| InChI | InChI=1S/C13H13N3O/c1-8-6-7-9(2)16(8)13-10-4-3-5-11(14)12(10)17-15-13/h3-7H,14H2,1-2H3 |
| InChIKey | LPUXVMBRNOFLFK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,5-dimethylpyrrol-1-yl)-1,2-benzoxazol-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dimethylpyrrol-1-yl)-1,2-benzoxazol-7-amine?
The IUPAC name of 3-(2,5-dimethylpyrrol-1-yl)-1,2-benzoxazol-7-amine (CID 126502324) is 3-(2,5-dimethylpyrrol-1-yl)-1,2-benzoxazol-7-amine.
What is the SMILES notation for 3-(2,5-dimethylpyrrol-1-yl)-1,2-benzoxazol-7-amine?
The canonical SMILES for 3-(2,5-dimethylpyrrol-1-yl)-1,2-benzoxazol-7-amine is Cc1ccc(C)n1-c1noc2c(N)cccc12.
What is the InChIKey of 3-(2,5-dimethylpyrrol-1-yl)-1,2-benzoxazol-7-amine?
The InChIKey is LPUXVMBRNOFLFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O/c1-8-6-7-9(2)16(8)13-10-4-3-5-11(14)12(10)17-15-13/h3-7H,14H2,1-2H3.
What are the key properties of 3-(2,5-dimethylpyrrol-1-yl)-1,2-benzoxazol-7-amine?
3-(2,5-dimethylpyrrol-1-yl)-1,2-benzoxazol-7-amine has a molecular weight of 227.27 g/mol, XLogP of 2.82, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dimethylpyrrol-1-yl)-1,2-benzoxazol-7-amine is sourced from PubChem (CID 126502324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).