C28H23N3O5S — CID 126502563
N-[2-[(3'-hydroxy-6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamothioylamino]ethyl]buta-2,3-dienamide (PubChem CID 126502563) has the molecular formula C28H23N3O5S and a molecular weight of 513.58 g/mol. Its IUPAC name is N-[2-[(3'-hydroxy-6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamothioylamino]ethyl]buta-2,3-dienamide.
| Compound Name | N-[2-[(3'-hydroxy-6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamothioylamino]ethyl]buta-2,3-dienamide |
|---|---|
| PubChem CID | 126502563 |
| Molecular Formula | C28H23N3O5S |
| Molecular Weight | 513.58 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | N-[2-[(3'-hydroxy-6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamothioylamino]ethyl]buta-2,3-dienamide |
| SMILES | C=C=CC(=O)NCCNC(=S)Nc1ccc2c(c1)C(=O)OC21c2ccc(C)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C28H23N3O5S/c1-3-4-25(33)29-11-12-30-27(37)31-17-6-9-20-19(14-17)26(34)36-28(20)21-8-5-16(2)13-23(21)35-24-15-18(32)7-10-22(24)28/h4-10,13-15,32H,1,11-12H2,2H3,(H,29,33)(H2,30,31,37) |
| InChIKey | ILNWYGZYXGBXGY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|