About tert-butyl (3R)-3-(cyclopropylsulfonylamino)-1-oxa-8-azaspiro[4.5]decane-8-carboxylate
tert-butyl (3R)-3-(cyclopropylsulfonylamino)-1-oxa-8-azaspiro[4.5]decane-8-carboxylate (PubChem CID 126502866) has the molecular formula C16H28N2O5S
and a molecular weight of 360.48 g/mol. Its IUPAC name is tert-butyl (3R)-3-(cyclopropylsulfonylamino)-1-oxa-8-azaspiro[4.5]decane-8-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (3R)-3-(cyclopropylsulfonylamino)-1-oxa-8-azaspiro[4.5]decane-8-carboxylate |
| PubChem CID | 126502866 |
| Molecular Formula | C16H28N2O5S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | tert-butyl (3R)-3-(cyclopropylsulfonylamino)-1-oxa-8-azaspiro[4.5]decane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)C[C@@H](NS(=O)(=O)C1CC1)CO2 |
| InChI | InChI=1S/C16H28N2O5S/c1-15(2,3)23-14(19)18-8-6-16(7-9-18)10-12(11-22-16)17-24(20,21)13-4-5-13/h12-13,17H,4-11H2,1-3H3/t12-/m1/s1 |
| InChIKey | ZDHQMIGHSFSOMU-GFCCVEGCSA-N |
| XLogP | 1.63 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl (3R)-3-(cyclopropylsulfonylamino)-1-oxa-8-azaspiro[4.5]decane-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3R)-3-(cyclopropylsulfonylamino)-1-oxa-8-azaspiro[4.5]decane-8-carboxylate?
The IUPAC name of tert-butyl (3R)-3-(cyclopropylsulfonylamino)-1-oxa-8-azaspiro[4.5]decane-8-carboxylate (CID 126502866) is tert-butyl (3R)-3-(cyclopropylsulfonylamino)-1-oxa-8-azaspiro[4.5]decane-8-carboxylate.
What is the SMILES notation for tert-butyl (3R)-3-(cyclopropylsulfonylamino)-1-oxa-8-azaspiro[4.5]decane-8-carboxylate?
The canonical SMILES for tert-butyl (3R)-3-(cyclopropylsulfonylamino)-1-oxa-8-azaspiro[4.5]decane-8-carboxylate is CC(C)(C)OC(=O)N1CCC2(CC1)C[C@@H](NS(=O)(=O)C1CC1)CO2.
What is the InChIKey of tert-butyl (3R)-3-(cyclopropylsulfonylamino)-1-oxa-8-azaspiro[4.5]decane-8-carboxylate?
The InChIKey is ZDHQMIGHSFSOMU-GFCCVEGCSA-N. The full InChI is InChI=1S/C16H28N2O5S/c1-15(2,3)23-14(19)18-8-6-16(7-9-18)10-12(11-22-16)17-24(20,21)13-4-5-13/h12-13,17H,4-11H2,1-3H3/t12-/m1/s1.
What are the key properties of tert-butyl (3R)-3-(cyclopropylsulfonylamino)-1-oxa-8-azaspiro[4.5]decane-8-carboxylate?
tert-butyl (3R)-3-(cyclopropylsulfonylamino)-1-oxa-8-azaspiro[4.5]decane-8-carboxylate has a molecular weight of 360.48 g/mol, XLogP of 1.63, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3R)-3-(cyclopropylsulfonylamino)-1-oxa-8-azaspiro[4.5]decane-8-carboxylate is sourced from PubChem (CID 126502866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).