C49H57FN2S2 — CID 126503069
4-[5-[4-(3-ethylheptyl)-2-fluorophenyl]thiophen-2-yl]-7-(7-pentyl-9,9-dipropylfluoren-2-yl)-2,1,3-benzothiadiazole (PubChem CID 126503069) has the molecular formula C49H57FN2S2 and a molecular weight of 757.14 g/mol. Its IUPAC name is 4-[5-[4-(3-ethylheptyl)-2-fluorophenyl]thiophen-2-yl]-7-(7-pentyl-9,9-dipropylfluoren-2-yl)-2,1,3-benzothiadiazole.
| Compound Name | 4-[5-[4-(3-ethylheptyl)-2-fluorophenyl]thiophen-2-yl]-7-(7-pentyl-9,9-dipropylfluoren-2-yl)-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 126503069 |
| Molecular Formula | C49H57FN2S2 |
| Molecular Weight | 757.14 g/mol |
| Exact Mass | 756.39 |
| IUPAC Name | 4-[5-[4-(3-ethylheptyl)-2-fluorophenyl]thiophen-2-yl]-7-(7-pentyl-9,9-dipropylfluoren-2-yl)-2,1,3-benzothiadiazole |
| SMILES | CCCCCc1ccc2c(c1)C(CCC)(CCC)c1cc(-c3ccc(-c4ccc(-c5ccc(CCC(CC)CCCC)cc5F)s4)c4nsnc34)ccc1-2 |
| InChI | InChI=1S/C49H57FN2S2/c1-6-11-13-15-34-18-21-38-39-23-20-36(32-43(39)49(28-8-3,29-9-4)42(38)30-34)37-24-25-41(48-47(37)51-54-52-48)46-27-26-45(53-46)40-22-19-35(31-44(40)50)17-16-33(10-5)14-12-7-2/h18-27,30-33H,6-17,28-29H2,1-5H3 |
| InChIKey | ORBJSMRUYMXLFI-UHFFFAOYSA-N |
| XLogP | 15.64 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.14 |
| LogP ≤ 5 | 15.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|