C29H29N5O4S — CID 126503646
2-[[3-[2-[3-[2-(2-methoxyethoxy)ethylcarbamoylamino]phenyl]ethynyl]-2H-indazol-6-yl]sulfanyl]-N-methylbenzamide (PubChem CID 126503646) has the molecular formula C29H29N5O4S and a molecular weight of 543.65 g/mol. Its IUPAC name is 2-[[3-[2-[3-[2-(2-methoxyethoxy)ethylcarbamoylamino]phenyl]ethynyl]-2H-indazol-6-yl]sulfanyl]-N-methylbenzamide.
| Compound Name | 2-[[3-[2-[3-[2-(2-methoxyethoxy)ethylcarbamoylamino]phenyl]ethynyl]-2H-indazol-6-yl]sulfanyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 126503646 |
| Molecular Formula | C29H29N5O4S |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | 2-[[3-[2-[3-[2-(2-methoxyethoxy)ethylcarbamoylamino]phenyl]ethynyl]-2H-indazol-6-yl]sulfanyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccccc1Sc1ccc2c(C#Cc3cccc(NC(=O)NCCOCCOC)c3)[nH]nc2c1 |
| InChI | InChI=1S/C29H29N5O4S/c1-30-28(35)24-8-3-4-9-27(24)39-22-11-12-23-25(33-34-26(23)19-22)13-10-20-6-5-7-21(18-20)32-29(36)31-14-15-38-17-16-37-2/h3-9,11-12,18-19H,14-17H2,1-2H3,(H,30,35)(H,33,34)(H2,31,32,36) |
| InChIKey | XDNZVZTWSOJXQQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 117.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|