About 2-hydroxydecyl N-tert-butylcarbamate
2-hydroxydecyl N-tert-butylcarbamate (PubChem CID 126503946) has the molecular formula C15H31NO3
and a molecular weight of 273.42 g/mol. Its IUPAC name is 2-hydroxydecyl N-tert-butylcarbamate.
Molecular Properties
| Compound Name | 2-hydroxydecyl N-tert-butylcarbamate |
| PubChem CID | 126503946 |
| Molecular Formula | C15H31NO3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.23 |
| IUPAC Name | 2-hydroxydecyl N-tert-butylcarbamate |
| SMILES | CCCCCCCCC(O)COC(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H31NO3/c1-5-6-7-8-9-10-11-13(17)12-19-14(18)16-15(2,3)4/h13,17H,5-12H2,1-4H3,(H,16,18) |
| InChIKey | OHYCAYHJDPOFIQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxydecyl N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxydecyl N-tert-butylcarbamate?
The IUPAC name of 2-hydroxydecyl N-tert-butylcarbamate (CID 126503946) is 2-hydroxydecyl N-tert-butylcarbamate.
What is the SMILES notation for 2-hydroxydecyl N-tert-butylcarbamate?
The canonical SMILES for 2-hydroxydecyl N-tert-butylcarbamate is CCCCCCCCC(O)COC(=O)NC(C)(C)C.
What is the InChIKey of 2-hydroxydecyl N-tert-butylcarbamate?
The InChIKey is OHYCAYHJDPOFIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NO3/c1-5-6-7-8-9-10-11-13(17)12-19-14(18)16-15(2,3)4/h13,17H,5-12H2,1-4H3,(H,16,18).
What are the key properties of 2-hydroxydecyl N-tert-butylcarbamate?
2-hydroxydecyl N-tert-butylcarbamate has a molecular weight of 273.42 g/mol, XLogP of 3.62, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxydecyl N-tert-butylcarbamate is sourced from PubChem (CID 126503946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).