C28H19Br2N3 — CID 126503965
2,4-bis(3-bromophenyl)-6-[3-(4-methylphenyl)phenyl]-1,3,5-triazine (PubChem CID 126503965) has the molecular formula C28H19Br2N3 and a molecular weight of 557.29 g/mol. Its IUPAC name is 2,4-bis(3-bromophenyl)-6-[3-(4-methylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(3-bromophenyl)-6-[3-(4-methylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 126503965 |
| Molecular Formula | C28H19Br2N3 |
| Molecular Weight | 557.29 g/mol |
| Exact Mass | 554.99 |
| IUPAC Name | 2,4-bis(3-bromophenyl)-6-[3-(4-methylphenyl)phenyl]-1,3,5-triazine |
| SMILES | Cc1ccc(-c2cccc(-c3nc(-c4cccc(Br)c4)nc(-c4cccc(Br)c4)n3)c2)cc1 |
| InChI | InChI=1S/C28H19Br2N3/c1-18-11-13-19(14-12-18)20-5-2-6-21(15-20)26-31-27(22-7-3-9-24(29)16-22)33-28(32-26)23-8-4-10-25(30)17-23/h2-17H,1H3 |
| InChIKey | OMZFUQYFSKVRDA-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.29 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |