About 7-ethoxy-1-(4-methoxy-3-thiophen-2-ylquinolin-6-yl)-3H-imidazo[4,5-b]pyridin-2-one
7-ethoxy-1-(4-methoxy-3-thiophen-2-ylquinolin-6-yl)-3H-imidazo[4,5-b]pyridin-2-one (PubChem CID 126504765) has the molecular formula C22H18N4O3S
and a molecular weight of 418.48 g/mol. Its IUPAC name is 7-ethoxy-1-(4-methoxy-3-thiophen-2-ylquinolin-6-yl)-3H-imidazo[4,5-b]pyridin-2-one.
Molecular Properties
| Compound Name | 7-ethoxy-1-(4-methoxy-3-thiophen-2-ylquinolin-6-yl)-3H-imidazo[4,5-b]pyridin-2-one |
| PubChem CID | 126504765 |
| Molecular Formula | C22H18N4O3S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 7-ethoxy-1-(4-methoxy-3-thiophen-2-ylquinolin-6-yl)-3H-imidazo[4,5-b]pyridin-2-one |
| SMILES | CCOc1ccnc2[nH]c(=O)n(-c3ccc4ncc(-c5cccs5)c(OC)c4c3)c12 |
| InChI | InChI=1S/C22H18N4O3S/c1-3-29-17-8-9-23-21-19(17)26(22(27)25-21)13-6-7-16-14(11-13)20(28-2)15(12-24-16)18-5-4-10-30-18/h4-12H,3H2,1-2H3,(H,23,25,27) |
| InChIKey | OTEVPLFGCPOLCG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7-ethoxy-1-(4-methoxy-3-thiophen-2-ylquinolin-6-yl)-3H-imidazo[4,5-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethoxy-1-(4-methoxy-3-thiophen-2-ylquinolin-6-yl)-3H-imidazo[4,5-b]pyridin-2-one?
The IUPAC name of 7-ethoxy-1-(4-methoxy-3-thiophen-2-ylquinolin-6-yl)-3H-imidazo[4,5-b]pyridin-2-one (CID 126504765) is 7-ethoxy-1-(4-methoxy-3-thiophen-2-ylquinolin-6-yl)-3H-imidazo[4,5-b]pyridin-2-one.
What is the SMILES notation for 7-ethoxy-1-(4-methoxy-3-thiophen-2-ylquinolin-6-yl)-3H-imidazo[4,5-b]pyridin-2-one?
The canonical SMILES for 7-ethoxy-1-(4-methoxy-3-thiophen-2-ylquinolin-6-yl)-3H-imidazo[4,5-b]pyridin-2-one is CCOc1ccnc2[nH]c(=O)n(-c3ccc4ncc(-c5cccs5)c(OC)c4c3)c12.
What is the InChIKey of 7-ethoxy-1-(4-methoxy-3-thiophen-2-ylquinolin-6-yl)-3H-imidazo[4,5-b]pyridin-2-one?
The InChIKey is OTEVPLFGCPOLCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N4O3S/c1-3-29-17-8-9-23-21-19(17)26(22(27)25-21)13-6-7-16-14(11-13)20(28-2)15(12-24-16)18-5-4-10-30-18/h4-12H,3H2,1-2H3,(H,23,25,27).
What are the key properties of 7-ethoxy-1-(4-methoxy-3-thiophen-2-ylquinolin-6-yl)-3H-imidazo[4,5-b]pyridin-2-one?
7-ethoxy-1-(4-methoxy-3-thiophen-2-ylquinolin-6-yl)-3H-imidazo[4,5-b]pyridin-2-one has a molecular weight of 418.48 g/mol, XLogP of 4.40, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethoxy-1-(4-methoxy-3-thiophen-2-ylquinolin-6-yl)-3H-imidazo[4,5-b]pyridin-2-one is sourced from PubChem (CID 126504765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).