C23H27F3N4O4S — CID 126505796
N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]phenyl]methyl]-3-(3-fluoropyrrolidin-1-yl)-N-phenylpropane-1-sulfonamide (PubChem CID 126505796) has the molecular formula C23H27F3N4O4S and a molecular weight of 512.55 g/mol. Its IUPAC name is N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]phenyl]methyl]-3-(3-fluoropyrrolidin-1-yl)-N-phenylpropane-1-sulfonamide.
| Compound Name | N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]phenyl]methyl]-3-(3-fluoropyrrolidin-1-yl)-N-phenylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 126505796 |
| Molecular Formula | C23H27F3N4O4S |
| Molecular Weight | 512.55 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]phenyl]methyl]-3-(3-fluoropyrrolidin-1-yl)-N-phenylpropane-1-sulfonamide |
| SMILES | O=C(NNC(=O)C(F)F)c1ccc(CN(c2ccccc2)S(=O)(=O)CCCN2CCC(F)C2)cc1 |
| InChI | InChI=1S/C23H27F3N4O4S/c24-19-11-13-29(16-19)12-4-14-35(33,34)30(20-5-2-1-3-6-20)15-17-7-9-18(10-8-17)22(31)27-28-23(32)21(25)26/h1-3,5-10,19,21H,4,11-16H2,(H,27,31)(H,28,32) |
| InChIKey | ZLWIXRJSAMDTTD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.55 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|