C21H27FN4O5S2 — CID 126506113
N-[3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]ethanesulfonamide (PubChem CID 126506113) has the molecular formula C21H27FN4O5S2 and a molecular weight of 498.60 g/mol. Its IUPAC name is N-[3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]ethanesulfonamide.
| Compound Name | N-[3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 126506113 |
| Molecular Formula | C21H27FN4O5S2 |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | N-[3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)N(Cc1ccc(C(=O)NN)cc1F)c1cccc(CN2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C21H27FN4O5S2/c1-2-33(30,31)26(15-18-7-6-17(13-20(18)22)21(27)24-23)19-5-3-4-16(12-19)14-25-8-10-32(28,29)11-9-25/h3-7,12-13H,2,8-11,14-15,23H2,1H3,(H,24,27) |
| InChIKey | DEVPNOVGLBUFBU-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|