C18H17F4N3O4S — CID 126506443
N-[[2-fluoro-4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]-N-(2-methylphenyl)methanesulfonamide (PubChem CID 126506443) has the molecular formula C18H17F4N3O4S and a molecular weight of 447.41 g/mol. Its IUPAC name is N-[[2-fluoro-4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]-N-(2-methylphenyl)methanesulfonamide.
| Compound Name | N-[[2-fluoro-4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]-N-(2-methylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 126506443 |
| Molecular Formula | C18H17F4N3O4S |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | N-[[2-fluoro-4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]-N-(2-methylphenyl)methanesulfonamide |
| SMILES | Cc1ccccc1N(Cc1ccc(C(=O)NNC(=O)C(F)(F)F)cc1F)S(C)(=O)=O |
| InChI | InChI=1S/C18H17F4N3O4S/c1-11-5-3-4-6-15(11)25(30(2,28)29)10-13-8-7-12(9-14(13)19)16(26)23-24-17(27)18(20,21)22/h3-9H,10H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | AQKKNQGQWUHYSB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|