C16H15F3N4O4S — CID 126506865
N-phenyl-N-[[5-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]-2-pyridinyl]methyl]methanesulfonamide (PubChem CID 126506865) has the molecular formula C16H15F3N4O4S and a molecular weight of 416.38 g/mol. Its IUPAC name is N-phenyl-N-[[5-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]-2-pyridinyl]methyl]methanesulfonamide.
| Compound Name | N-phenyl-N-[[5-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]-2-pyridinyl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 126506865 |
| Molecular Formula | C16H15F3N4O4S |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | N-phenyl-N-[[5-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]-2-pyridinyl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N(Cc1ccc(C(=O)NNC(=O)C(F)(F)F)cn1)c1ccccc1 |
| InChI | InChI=1S/C16H15F3N4O4S/c1-28(26,27)23(13-5-3-2-4-6-13)10-12-8-7-11(9-20-12)14(24)21-22-15(25)16(17,18)19/h2-9H,10H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | IFJKPEWINPBCEJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|