About 4-(1,2,3,6-tetrahydropyridin-4-yl)oxane-4-carbonitrile
4-(1,2,3,6-tetrahydropyridin-4-yl)oxane-4-carbonitrile (PubChem CID 126506916) has the molecular formula C11H16N2O
and a molecular weight of 192.26 g/mol. Its IUPAC name is 4-(1,2,3,6-tetrahydropyridin-4-yl)oxane-4-carbonitrile.
Molecular Properties
| Compound Name | 4-(1,2,3,6-tetrahydropyridin-4-yl)oxane-4-carbonitrile |
| PubChem CID | 126506916 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 4-(1,2,3,6-tetrahydropyridin-4-yl)oxane-4-carbonitrile |
| SMILES | N#CC1(C2=CCNCC2)CCOCC1 |
| InChI | InChI=1S/C11H16N2O/c12-9-11(3-7-14-8-4-11)10-1-5-13-6-2-10/h1,13H,2-8H2 |
| InChIKey | BBDZWRUHCHEGDF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,2,3,6-tetrahydropyridin-4-yl)oxane-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,2,3,6-tetrahydropyridin-4-yl)oxane-4-carbonitrile?
The IUPAC name of 4-(1,2,3,6-tetrahydropyridin-4-yl)oxane-4-carbonitrile (CID 126506916) is 4-(1,2,3,6-tetrahydropyridin-4-yl)oxane-4-carbonitrile.
What is the SMILES notation for 4-(1,2,3,6-tetrahydropyridin-4-yl)oxane-4-carbonitrile?
The canonical SMILES for 4-(1,2,3,6-tetrahydropyridin-4-yl)oxane-4-carbonitrile is N#CC1(C2=CCNCC2)CCOCC1.
What is the InChIKey of 4-(1,2,3,6-tetrahydropyridin-4-yl)oxane-4-carbonitrile?
The InChIKey is BBDZWRUHCHEGDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O/c12-9-11(3-7-14-8-4-11)10-1-5-13-6-2-10/h1,13H,2-8H2.
What are the key properties of 4-(1,2,3,6-tetrahydropyridin-4-yl)oxane-4-carbonitrile?
4-(1,2,3,6-tetrahydropyridin-4-yl)oxane-4-carbonitrile has a molecular weight of 192.26 g/mol, XLogP of 1.23, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2,3,6-tetrahydropyridin-4-yl)oxane-4-carbonitrile is sourced from PubChem (CID 126506916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).