C16H27F3N4O7S2 — CID 126508169
tert-butyl (2R,6S)-2,6-dimethyl-4-(3-methylimidazol-3-ium-1-yl)sulfonylpiperazine-1-carboxylate;trifluoromethanesulfonate (PubChem CID 126508169) has the molecular formula C16H27F3N4O7S2 and a molecular weight of 508.54 g/mol. Its IUPAC name is tert-butyl (2R,6S)-2,6-dimethyl-4-(3-methylimidazol-3-ium-1-yl)sulfonylpiperazine-1-carboxylate;trifluoromethanesulfonate.
| Compound Name | tert-butyl (2R,6S)-2,6-dimethyl-4-(3-methylimidazol-3-ium-1-yl)sulfonylpiperazine-1-carboxylate;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 126508169 |
| Molecular Formula | C16H27F3N4O7S2 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | tert-butyl (2R,6S)-2,6-dimethyl-4-(3-methylimidazol-3-ium-1-yl)sulfonylpiperazine-1-carboxylate;trifluoromethanesulfonate |
| SMILES | C[C@@H]1CN(S(=O)(=O)n2cc[n+](C)c2)C[C@H](C)N1C(=O)OC(C)(C)C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C15H27N4O4S.CHF3O3S/c1-12-9-18(24(21,22)17-8-7-16(6)11-17)10-13(2)19(12)14(20)23-15(3,4)5;2-1(3,4)8(5,6)7/h7-8,11-13H,9-10H2,1-6H3;(H,5,6,7)/q+1;/p-1/t12-,13+; |
| InChIKey | VGPXYZFSDALBIH-OEEJBDNKSA-M |
| XLogP | 0.79 |
| TPSA | 132.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|