C29H32ClF2N3O3 — CID 126508548
(6R,10S)-10-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-6-methylspiro[4,12-diazabicyclo[9.3.1]pentadeca-1(15),11,13-triene-2,4'-oxane]-5-one (PubChem CID 126508548) has the molecular formula C29H32ClF2N3O3 and a molecular weight of 544.04 g/mol. Its IUPAC name is (6R,10S)-10-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-6-methylspiro[4,12-diazabicyclo[9.3.1]pentadeca-1(15),11,13-triene-2,4'-oxane]-5-one.
| Compound Name | (6R,10S)-10-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-6-methylspiro[4,12-diazabicyclo[9.3.1]pentadeca-1(15),11,13-triene-2,4'-oxane]-5-one |
|---|---|
| PubChem CID | 126508548 |
| Molecular Formula | C29H32ClF2N3O3 |
| Molecular Weight | 544.04 g/mol |
| Exact Mass | 543.21 |
| IUPAC Name | (6R,10S)-10-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-6-methylspiro[4,12-diazabicyclo[9.3.1]pentadeca-1(15),11,13-triene-2,4'-oxane]-5-one |
| SMILES | C[C@@H]1CCC[C@H](N2CCC(c3c(F)ccc(Cl)c3F)=CC2=O)c2cc(ccn2)C2(CCOCC2)CNC1=O |
| InChI | InChI=1S/C29H32ClF2N3O3/c1-18-3-2-4-24(35-12-8-19(15-25(35)36)26-22(31)6-5-21(30)27(26)32)23-16-20(7-11-33-23)29(17-34-28(18)37)9-13-38-14-10-29/h5-7,11,15-16,18,24H,2-4,8-10,12-14,17H2,1H3,(H,34,37)/t18-,24+/m1/s1 |
| InChIKey | MEZPOPBRLPHIAC-KOSHJBKYSA-N |
| XLogP | 5.35 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.04 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|