C21H23NO4 — CID 126508562
5-[(2S)-2-[(3aR,5S)-6-oxo-5-prop-2-enyl-4,5-dihydro-1,3-benzodioxol-3a-yl]propyl]-2-methoxybenzonitrile (PubChem CID 126508562) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is 5-[(2S)-2-[(3aR,5S)-6-oxo-5-prop-2-enyl-4,5-dihydro-1,3-benzodioxol-3a-yl]propyl]-2-methoxybenzonitrile.
| Compound Name | 5-[(2S)-2-[(3aR,5S)-6-oxo-5-prop-2-enyl-4,5-dihydro-1,3-benzodioxol-3a-yl]propyl]-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 126508562 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 5-[(2S)-2-[(3aR,5S)-6-oxo-5-prop-2-enyl-4,5-dihydro-1,3-benzodioxol-3a-yl]propyl]-2-methoxybenzonitrile |
| SMILES | C=CC[C@H]1C[C@]2([C@@H](C)Cc3ccc(OC)c(C#N)c3)OCOC2=CC1=O |
| InChI | InChI=1S/C21H23NO4/c1-4-5-16-11-21(20(10-18(16)23)25-13-26-21)14(2)8-15-6-7-19(24-3)17(9-15)12-22/h4,6-7,9-10,14,16H,1,5,8,11,13H2,2-3H3/t14-,16-,21+/m0/s1 |
| InChIKey | JWKVIBKLNXCNLK-WDUKFBBWSA-N |
| XLogP | 3.54 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|