C22H26O6 — CID 126508808
[5-[2-[(3aR,5S)-6-oxo-5-prop-2-enyl-4,5-dihydro-1,3-benzodioxol-3a-yl]propyl]-2-methoxyphenyl] acetate (PubChem CID 126508808) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is [5-[2-[(3aR,5S)-6-oxo-5-prop-2-enyl-4,5-dihydro-1,3-benzodioxol-3a-yl]propyl]-2-methoxyphenyl] acetate.
| Compound Name | [5-[2-[(3aR,5S)-6-oxo-5-prop-2-enyl-4,5-dihydro-1,3-benzodioxol-3a-yl]propyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 126508808 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | [5-[2-[(3aR,5S)-6-oxo-5-prop-2-enyl-4,5-dihydro-1,3-benzodioxol-3a-yl]propyl]-2-methoxyphenyl] acetate |
| SMILES | C=CC[C@H]1C[C@]2(C(C)Cc3ccc(OC)c(OC(C)=O)c3)OCOC2=CC1=O |
| InChI | InChI=1S/C22H26O6/c1-5-6-17-12-22(21(11-18(17)24)26-13-27-22)14(2)9-16-7-8-19(25-4)20(10-16)28-15(3)23/h5,7-8,10-11,14,17H,1,6,9,12-13H2,2-4H3/t14?,17-,22+/m0/s1 |
| InChIKey | RDTRKDTYAPWOPR-LYOOYEMJSA-N |
| XLogP | 3.59 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|