About 5-ethoxy-4,5-dimethyl-2-oxo-1H-pyrrole-3-carbonitrile
5-ethoxy-4,5-dimethyl-2-oxo-1H-pyrrole-3-carbonitrile (PubChem CID 12650891) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is 5-ethoxy-4,5-dimethyl-2-oxo-1H-pyrrole-3-carbonitrile.
Molecular Properties
| Compound Name | 5-ethoxy-4,5-dimethyl-2-oxo-1H-pyrrole-3-carbonitrile |
| PubChem CID | 12650891 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 5-ethoxy-4,5-dimethyl-2-oxo-1H-pyrrole-3-carbonitrile |
| SMILES | CCOC1(C)NC(=O)C(C#N)=C1C |
| InChI | InChI=1S/C9H12N2O2/c1-4-13-9(3)6(2)7(5-10)8(12)11-9/h4H2,1-3H3,(H,11,12) |
| InChIKey | ADUMVNQFYMUYGK-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethoxy-4,5-dimethyl-2-oxo-1H-pyrrole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-4,5-dimethyl-2-oxo-1H-pyrrole-3-carbonitrile?
The IUPAC name of 5-ethoxy-4,5-dimethyl-2-oxo-1H-pyrrole-3-carbonitrile (CID 12650891) is 5-ethoxy-4,5-dimethyl-2-oxo-1H-pyrrole-3-carbonitrile.
What is the SMILES notation for 5-ethoxy-4,5-dimethyl-2-oxo-1H-pyrrole-3-carbonitrile?
The canonical SMILES for 5-ethoxy-4,5-dimethyl-2-oxo-1H-pyrrole-3-carbonitrile is CCOC1(C)NC(=O)C(C#N)=C1C.
What is the InChIKey of 5-ethoxy-4,5-dimethyl-2-oxo-1H-pyrrole-3-carbonitrile?
The InChIKey is ADUMVNQFYMUYGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-4-13-9(3)6(2)7(5-10)8(12)11-9/h4H2,1-3H3,(H,11,12).
What are the key properties of 5-ethoxy-4,5-dimethyl-2-oxo-1H-pyrrole-3-carbonitrile?
5-ethoxy-4,5-dimethyl-2-oxo-1H-pyrrole-3-carbonitrile has a molecular weight of 180.21 g/mol, XLogP of 0.71, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-4,5-dimethyl-2-oxo-1H-pyrrole-3-carbonitrile is sourced from PubChem (CID 12650891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).