C13H19N3O4S — CID 126509085
(2R,6S)-2,6-dimethyl-4-(phenylsulfamoyl)piperazine-1-carboxylic acid (PubChem CID 126509085) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is (2R,6S)-2,6-dimethyl-4-(phenylsulfamoyl)piperazine-1-carboxylic acid.
| Compound Name | (2R,6S)-2,6-dimethyl-4-(phenylsulfamoyl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 126509085 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (2R,6S)-2,6-dimethyl-4-(phenylsulfamoyl)piperazine-1-carboxylic acid |
| SMILES | C[C@@H]1CN(S(=O)(=O)Nc2ccccc2)C[C@H](C)N1C(=O)O |
| InChI | InChI=1S/C13H19N3O4S/c1-10-8-15(9-11(2)16(10)13(17)18)21(19,20)14-12-6-4-3-5-7-12/h3-7,10-11,14H,8-9H2,1-2H3,(H,17,18)/t10-,11+ |
| InChIKey | BRTWARHAHFPJQF-PHIMTYICSA-N |
| XLogP | 1.42 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |