C21H24FNO5 — CID 126509248
5-[2-[(3aR,5S)-6-oxo-5-prop-2-enyl-4,5-dihydro-1,3-benzodioxol-3a-yl]propyl]-4-fluoro-2-methoxybenzamide (PubChem CID 126509248) has the molecular formula C21H24FNO5 and a molecular weight of 389.42 g/mol. Its IUPAC name is 5-[2-[(3aR,5S)-6-oxo-5-prop-2-enyl-4,5-dihydro-1,3-benzodioxol-3a-yl]propyl]-4-fluoro-2-methoxybenzamide.
| Compound Name | 5-[2-[(3aR,5S)-6-oxo-5-prop-2-enyl-4,5-dihydro-1,3-benzodioxol-3a-yl]propyl]-4-fluoro-2-methoxybenzamide |
|---|---|
| PubChem CID | 126509248 |
| Molecular Formula | C21H24FNO5 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 5-[2-[(3aR,5S)-6-oxo-5-prop-2-enyl-4,5-dihydro-1,3-benzodioxol-3a-yl]propyl]-4-fluoro-2-methoxybenzamide |
| SMILES | C=CC[C@H]1C[C@]2(C(C)Cc3cc(C(N)=O)c(OC)cc3F)OCOC2=CC1=O |
| InChI | InChI=1S/C21H24FNO5/c1-4-5-13-10-21(19(9-17(13)24)27-11-28-21)12(2)6-14-7-15(20(23)25)18(26-3)8-16(14)22/h4,7-9,12-13H,1,5-6,10-11H2,2-3H3,(H2,23,25)/t12?,13-,21+/m0/s1 |
| InChIKey | WTVZWMIYFHBWAJ-OMCCKBBRSA-N |
| XLogP | 2.90 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|