About 3-methyl-2-pyrazolo[5,4-b]pyridin-1-ylpyridine-4-carboxamide
3-methyl-2-pyrazolo[5,4-b]pyridin-1-ylpyridine-4-carboxamide (PubChem CID 126509405) has the molecular formula C13H11N5O
and a molecular weight of 253.27 g/mol. Its IUPAC name is 3-methyl-2-pyrazolo[5,4-b]pyridin-1-ylpyridine-4-carboxamide.
Molecular Properties
| Compound Name | 3-methyl-2-pyrazolo[5,4-b]pyridin-1-ylpyridine-4-carboxamide |
| PubChem CID | 126509405 |
| Molecular Formula | C13H11N5O |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 3-methyl-2-pyrazolo[5,4-b]pyridin-1-ylpyridine-4-carboxamide |
| SMILES | Cc1c(C(N)=O)ccnc1-n1ncc2cccnc21 |
| InChI | InChI=1S/C13H11N5O/c1-8-10(11(14)19)4-6-16-12(8)18-13-9(7-17-18)3-2-5-15-13/h2-7H,1H3,(H2,14,19) |
| InChIKey | SVALDWFXGKRZMU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methyl-2-pyrazolo[5,4-b]pyridin-1-ylpyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-pyrazolo[5,4-b]pyridin-1-ylpyridine-4-carboxamide?
The IUPAC name of 3-methyl-2-pyrazolo[5,4-b]pyridin-1-ylpyridine-4-carboxamide (CID 126509405) is 3-methyl-2-pyrazolo[5,4-b]pyridin-1-ylpyridine-4-carboxamide.
What is the SMILES notation for 3-methyl-2-pyrazolo[5,4-b]pyridin-1-ylpyridine-4-carboxamide?
The canonical SMILES for 3-methyl-2-pyrazolo[5,4-b]pyridin-1-ylpyridine-4-carboxamide is Cc1c(C(N)=O)ccnc1-n1ncc2cccnc21.
What is the InChIKey of 3-methyl-2-pyrazolo[5,4-b]pyridin-1-ylpyridine-4-carboxamide?
The InChIKey is SVALDWFXGKRZMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N5O/c1-8-10(11(14)19)4-6-16-12(8)18-13-9(7-17-18)3-2-5-15-13/h2-7H,1H3,(H2,14,19).
What are the key properties of 3-methyl-2-pyrazolo[5,4-b]pyridin-1-ylpyridine-4-carboxamide?
3-methyl-2-pyrazolo[5,4-b]pyridin-1-ylpyridine-4-carboxamide has a molecular weight of 253.27 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-pyrazolo[5,4-b]pyridin-1-ylpyridine-4-carboxamide is sourced from PubChem (CID 126509405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).