C21H25NO5 — CID 126509472
5-[(2S)-2-[(3aR,5S)-6-oxo-5-prop-2-enyl-4,5-dihydro-1,3-benzodioxol-3a-yl]propyl]-2-methoxybenzamide (PubChem CID 126509472) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is 5-[(2S)-2-[(3aR,5S)-6-oxo-5-prop-2-enyl-4,5-dihydro-1,3-benzodioxol-3a-yl]propyl]-2-methoxybenzamide.
| Compound Name | 5-[(2S)-2-[(3aR,5S)-6-oxo-5-prop-2-enyl-4,5-dihydro-1,3-benzodioxol-3a-yl]propyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 126509472 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 5-[(2S)-2-[(3aR,5S)-6-oxo-5-prop-2-enyl-4,5-dihydro-1,3-benzodioxol-3a-yl]propyl]-2-methoxybenzamide |
| SMILES | C=CC[C@H]1C[C@]2([C@@H](C)Cc3ccc(OC)c(C(N)=O)c3)OCOC2=CC1=O |
| InChI | InChI=1S/C21H25NO5/c1-4-5-15-11-21(19(10-17(15)23)26-12-27-21)13(2)8-14-6-7-18(25-3)16(9-14)20(22)24/h4,6-7,9-10,13,15H,1,5,8,11-12H2,2-3H3,(H2,22,24)/t13-,15-,21+/m0/s1 |
| InChIKey | AISIRJVVNJHGOI-XLDJFRKUSA-N |
| XLogP | 2.76 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|