C21H24O5 — CID 126509696
[4-[(2S)-2-[(3aR,5S)-6-oxo-5-prop-2-enyl-4,5-dihydro-3H-1,2-benzodioxol-3a-yl]propyl]phenyl] acetate (PubChem CID 126509696) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is [4-[(2S)-2-[(3aR,5S)-6-oxo-5-prop-2-enyl-4,5-dihydro-3H-1,2-benzodioxol-3a-yl]propyl]phenyl] acetate.
| Compound Name | [4-[(2S)-2-[(3aR,5S)-6-oxo-5-prop-2-enyl-4,5-dihydro-3H-1,2-benzodioxol-3a-yl]propyl]phenyl] acetate |
|---|---|
| PubChem CID | 126509696 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | [4-[(2S)-2-[(3aR,5S)-6-oxo-5-prop-2-enyl-4,5-dihydro-3H-1,2-benzodioxol-3a-yl]propyl]phenyl] acetate |
| SMILES | C=CC[C@H]1C[C@@]2([C@@H](C)Cc3ccc(OC(C)=O)cc3)COOC2=CC1=O |
| InChI | InChI=1S/C21H24O5/c1-4-5-17-12-21(13-24-26-20(21)11-19(17)23)14(2)10-16-6-8-18(9-7-16)25-15(3)22/h4,6-9,11,14,17H,1,5,10,12-13H2,2-3H3/t14-,17-,21-/m0/s1 |
| InChIKey | IBZLVVLXDHTZGR-LFRPXUGBSA-N |
| XLogP | 3.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|