About 2-aminobutanedithial
2-aminobutanedithial (PubChem CID 126510085) has the molecular formula C4H7NS2
and a molecular weight of 133.24 g/mol. Its IUPAC name is 2-aminobutanedithial.
Molecular Properties
| Compound Name | 2-aminobutanedithial |
| PubChem CID | 126510085 |
| Molecular Formula | C4H7NS2 |
| Molecular Weight | 133.24 g/mol |
| Exact Mass | 133.00 |
| IUPAC Name | 2-aminobutanedithial |
| SMILES | NC(C=S)CC=S |
| InChI | InChI=1S/C4H7NS2/c5-4(3-7)1-2-6/h2-4H,1,5H2 |
| InChIKey | AUFGHAUYOMAWDT-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.24 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobutanedithial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobutanedithial?
The IUPAC name of 2-aminobutanedithial (CID 126510085) is 2-aminobutanedithial.
What is the SMILES notation for 2-aminobutanedithial?
The canonical SMILES for 2-aminobutanedithial is NC(C=S)CC=S.
What is the InChIKey of 2-aminobutanedithial?
The InChIKey is AUFGHAUYOMAWDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NS2/c5-4(3-7)1-2-6/h2-4H,1,5H2.
What are the key properties of 2-aminobutanedithial?
2-aminobutanedithial has a molecular weight of 133.24 g/mol, XLogP of 0.70, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobutanedithial is sourced from PubChem (CID 126510085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).