About 6-iodo-3-methylfuro[3,2-b]furan-2,5-dione
6-iodo-3-methylfuro[3,2-b]furan-2,5-dione (PubChem CID 126511261) has the molecular formula C7H3IO4
and a molecular weight of 278.00 g/mol. Its IUPAC name is 6-iodo-3-methylfuro[3,2-b]furan-2,5-dione.
Molecular Properties
| Compound Name | 6-iodo-3-methylfuro[3,2-b]furan-2,5-dione |
| PubChem CID | 126511261 |
| Molecular Formula | C7H3IO4 |
| Molecular Weight | 278.00 g/mol |
| Exact Mass | 277.91 |
| IUPAC Name | 6-iodo-3-methylfuro[3,2-b]furan-2,5-dione |
| SMILES | CC1=C2OC(=O)C(I)=C2OC1=O |
| InChI | InChI=1S/C7H3IO4/c1-2-4-5(12-6(2)9)3(8)7(10)11-4/h1H3 |
| InChIKey | ZBEHLBMMCVKFKH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.00 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-3-methylfuro[3,2-b]furan-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-3-methylfuro[3,2-b]furan-2,5-dione?
The IUPAC name of 6-iodo-3-methylfuro[3,2-b]furan-2,5-dione (CID 126511261) is 6-iodo-3-methylfuro[3,2-b]furan-2,5-dione.
What is the SMILES notation for 6-iodo-3-methylfuro[3,2-b]furan-2,5-dione?
The canonical SMILES for 6-iodo-3-methylfuro[3,2-b]furan-2,5-dione is CC1=C2OC(=O)C(I)=C2OC1=O.
What is the InChIKey of 6-iodo-3-methylfuro[3,2-b]furan-2,5-dione?
The InChIKey is ZBEHLBMMCVKFKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3IO4/c1-2-4-5(12-6(2)9)3(8)7(10)11-4/h1H3.
What are the key properties of 6-iodo-3-methylfuro[3,2-b]furan-2,5-dione?
6-iodo-3-methylfuro[3,2-b]furan-2,5-dione has a molecular weight of 278.00 g/mol, XLogP of 1.02, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-3-methylfuro[3,2-b]furan-2,5-dione is sourced from PubChem (CID 126511261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).