About bis(oxiran-2-ylmethyl) bicyclo[2.2.1]hept-2-ene-1,2-dicarboxylate
bis(oxiran-2-ylmethyl) bicyclo[2.2.1]hept-2-ene-1,2-dicarboxylate (PubChem CID 126511446) has the molecular formula C15H18O6
and a molecular weight of 294.30 g/mol. Its IUPAC name is bis(oxiran-2-ylmethyl) bicyclo[2.2.1]hept-2-ene-1,2-dicarboxylate.
Molecular Properties
| Compound Name | bis(oxiran-2-ylmethyl) bicyclo[2.2.1]hept-2-ene-1,2-dicarboxylate |
| PubChem CID | 126511446 |
| Molecular Formula | C15H18O6 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | bis(oxiran-2-ylmethyl) bicyclo[2.2.1]hept-2-ene-1,2-dicarboxylate |
| SMILES | O=C(OCC1CO1)C1=CC2CCC1(C(=O)OCC1CO1)C2 |
| InChI | InChI=1S/C15H18O6/c16-13(20-7-10-5-18-10)12-3-9-1-2-15(12,4-9)14(17)21-8-11-6-19-11/h3,9-11H,1-2,4-8H2 |
| InChIKey | RFTHMOTXNJWQFO-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 77.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze bis(oxiran-2-ylmethyl) bicyclo[2.2.1]hept-2-ene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(oxiran-2-ylmethyl) bicyclo[2.2.1]hept-2-ene-1,2-dicarboxylate?
The IUPAC name of bis(oxiran-2-ylmethyl) bicyclo[2.2.1]hept-2-ene-1,2-dicarboxylate (CID 126511446) is bis(oxiran-2-ylmethyl) bicyclo[2.2.1]hept-2-ene-1,2-dicarboxylate.
What is the SMILES notation for bis(oxiran-2-ylmethyl) bicyclo[2.2.1]hept-2-ene-1,2-dicarboxylate?
The canonical SMILES for bis(oxiran-2-ylmethyl) bicyclo[2.2.1]hept-2-ene-1,2-dicarboxylate is O=C(OCC1CO1)C1=CC2CCC1(C(=O)OCC1CO1)C2.
What is the InChIKey of bis(oxiran-2-ylmethyl) bicyclo[2.2.1]hept-2-ene-1,2-dicarboxylate?
The InChIKey is RFTHMOTXNJWQFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O6/c16-13(20-7-10-5-18-10)12-3-9-1-2-15(12,4-9)14(17)21-8-11-6-19-11/h3,9-11H,1-2,4-8H2.
What are the key properties of bis(oxiran-2-ylmethyl) bicyclo[2.2.1]hept-2-ene-1,2-dicarboxylate?
bis(oxiran-2-ylmethyl) bicyclo[2.2.1]hept-2-ene-1,2-dicarboxylate has a molecular weight of 294.30 g/mol, XLogP of 0.60, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(oxiran-2-ylmethyl) bicyclo[2.2.1]hept-2-ene-1,2-dicarboxylate is sourced from PubChem (CID 126511446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).