C25H38O7 — CID 126511504
(3R,5S,8R,9S,10S,13R,14S,17S)-3-acetyloxy-17-[(1R)-1-acetyloxy-1-hydroxyethyl]-10-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-13-carboxylic acid (PubChem CID 126511504) has the molecular formula C25H38O7 and a molecular weight of 450.57 g/mol. Its IUPAC name is (3R,5S,8R,9S,10S,13R,14S,17S)-3-acetyloxy-17-[(1R)-1-acetyloxy-1-hydroxyethyl]-10-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-13-carboxylic acid.
| Compound Name | (3R,5S,8R,9S,10S,13R,14S,17S)-3-acetyloxy-17-[(1R)-1-acetyloxy-1-hydroxyethyl]-10-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-13-carboxylic acid |
|---|---|
| PubChem CID | 126511504 |
| Molecular Formula | C25H38O7 |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | (3R,5S,8R,9S,10S,13R,14S,17S)-3-acetyloxy-17-[(1R)-1-acetyloxy-1-hydroxyethyl]-10-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-13-carboxylic acid |
| SMILES | CC(=O)O[C@@H]1CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@@]2(C(=O)O)[C@H]3CC[C@@H]2[C@](C)(O)OC(C)=O)C1 |
| InChI | InChI=1S/C25H38O7/c1-14(26)31-17-9-11-23(3)16(13-17)5-6-18-19(23)10-12-25(22(28)29)20(18)7-8-21(25)24(4,30)32-15(2)27/h16-21,30H,5-13H2,1-4H3,(H,28,29)/t16-,17+,18+,19-,20-,21+,23-,24+,25+/m0/s1 |
| InChIKey | RGUSXWOLXJBHHE-GFPMZTFUSA-N |
| XLogP | 3.91 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|