C7H12Br2 — CID 12651156
1,1-bis(bromomethyl)cyclopentane (PubChem CID 12651156) has the molecular formula C7H12Br2 and a molecular weight of 255.98 g/mol. Its IUPAC name is 1,1-bis(bromomethyl)cyclopentane.
| Compound Name | 1,1-bis(bromomethyl)cyclopentane |
|---|---|
| PubChem CID | 12651156 |
| Molecular Formula | C7H12Br2 |
| Molecular Weight | 255.98 g/mol |
| Exact Mass | 253.93 |
| IUPAC Name | 1,1-bis(bromomethyl)cyclopentane |
| SMILES | BrCC1(CBr)CCCC1 |
| InChI | InChI=1S/C7H12Br2/c8-5-7(6-9)3-1-2-4-7/h1-6H2 |
| InChIKey | IHACFZDNHHZUIN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.98 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|