C24H33NO3 — CID 126511591
(1S,2R)-2-[3-(5-phenylmethoxypentoxy)propoxy]-2,3-dihydro-1H-inden-1-amine (PubChem CID 126511591) has the molecular formula C24H33NO3 and a molecular weight of 383.53 g/mol. Its IUPAC name is (1S,2R)-2-[3-(5-phenylmethoxypentoxy)propoxy]-2,3-dihydro-1H-inden-1-amine.
| Compound Name | (1S,2R)-2-[3-(5-phenylmethoxypentoxy)propoxy]-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 126511591 |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | (1S,2R)-2-[3-(5-phenylmethoxypentoxy)propoxy]-2,3-dihydro-1H-inden-1-amine |
| SMILES | N[C@H]1c2ccccc2C[C@H]1OCCCOCCCCCOCc1ccccc1 |
| InChI | InChI=1S/C24H33NO3/c25-24-22-13-6-5-12-21(22)18-23(24)28-17-9-16-26-14-7-2-8-15-27-19-20-10-3-1-4-11-20/h1,3-6,10-13,23-24H,2,7-9,14-19,25H2/t23-,24+/m1/s1 |
| InChIKey | MGTQEPGWLWADAL-RPWUZVMVSA-N |
| XLogP | 4.42 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|