About spiro[3.5]nonane
spiro[3.5]nonane (PubChem CID 12651160) has the molecular formula C9H16
and a molecular weight of 124.23 g/mol. Its IUPAC name is spiro[3.5]nonane.
Molecular Properties
| Compound Name | spiro[3.5]nonane |
| PubChem CID | 12651160 |
| Molecular Formula | C9H16 |
| Molecular Weight | 124.23 g/mol |
| Exact Mass | 124.13 |
| IUPAC Name | spiro[3.5]nonane |
| SMILES | C1CCC2(CC1)CCC2 |
| InChI | InChI=1S/C9H16/c1-2-5-9(6-3-1)7-4-8-9/h1-8H2 |
| InChIKey | VMWOETMUNAQFAX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.23 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze spiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[3.5]nonane?
The IUPAC name of spiro[3.5]nonane (CID 12651160) is spiro[3.5]nonane.
What is the SMILES notation for spiro[3.5]nonane?
The canonical SMILES for spiro[3.5]nonane is C1CCC2(CC1)CCC2.
What is the InChIKey of spiro[3.5]nonane?
The InChIKey is VMWOETMUNAQFAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16/c1-2-5-9(6-3-1)7-4-8-9/h1-8H2.
What are the key properties of spiro[3.5]nonane?
spiro[3.5]nonane has a molecular weight of 124.23 g/mol, XLogP of 3.12, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[3.5]nonane is sourced from PubChem (CID 12651160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).