C19H18FN7 — CID 126511662
5-[4-[(1R)-1-azido-7-fluoro-2,3-dihydro-1H-inden-4-yl]-3,5-dimethylphenyl]-2-methyltetrazole (PubChem CID 126511662) has the molecular formula C19H18FN7 and a molecular weight of 363.40 g/mol. Its IUPAC name is 5-[4-[(1R)-1-azido-7-fluoro-2,3-dihydro-1H-inden-4-yl]-3,5-dimethylphenyl]-2-methyltetrazole.
| Compound Name | 5-[4-[(1R)-1-azido-7-fluoro-2,3-dihydro-1H-inden-4-yl]-3,5-dimethylphenyl]-2-methyltetrazole |
|---|---|
| PubChem CID | 126511662 |
| Molecular Formula | C19H18FN7 |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 5-[4-[(1R)-1-azido-7-fluoro-2,3-dihydro-1H-inden-4-yl]-3,5-dimethylphenyl]-2-methyltetrazole |
| SMILES | Cc1cc(-c2nnn(C)n2)cc(C)c1-c1ccc(F)c2c1CC[C@H]2N=[N+]=[N-] |
| InChI | InChI=1S/C19H18FN7/c1-10-8-12(19-23-26-27(3)24-19)9-11(2)17(10)13-4-6-15(20)18-14(13)5-7-16(18)22-25-21/h4,6,8-9,16H,5,7H2,1-3H3/t16-/m1/s1 |
| InChIKey | TWWCZWMWMIWEOF-MRXNPFEDSA-N |
| XLogP | 4.60 |
| TPSA | 92.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|