About 4-(3,3-dimethyl-2H-1-benzofuran-5-yl)-2,5-dihydropyridine
4-(3,3-dimethyl-2H-1-benzofuran-5-yl)-2,5-dihydropyridine (PubChem CID 126512302) has the molecular formula C15H17NO
and a molecular weight of 227.31 g/mol. Its IUPAC name is 4-(3,3-dimethyl-2H-1-benzofuran-5-yl)-2,5-dihydropyridine.
Molecular Properties
| Compound Name | 4-(3,3-dimethyl-2H-1-benzofuran-5-yl)-2,5-dihydropyridine |
| PubChem CID | 126512302 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 4-(3,3-dimethyl-2H-1-benzofuran-5-yl)-2,5-dihydropyridine |
| SMILES | CC1(C)COc2ccc(C3=CCN=CC3)cc21 |
| InChI | InChI=1S/C15H17NO/c1-15(2)10-17-14-4-3-12(9-13(14)15)11-5-7-16-8-6-11/h3-5,8-9H,6-7,10H2,1-2H3 |
| InChIKey | RQGNHOOLHFDKCI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3,3-dimethyl-2H-1-benzofuran-5-yl)-2,5-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3-dimethyl-2H-1-benzofuran-5-yl)-2,5-dihydropyridine?
The IUPAC name of 4-(3,3-dimethyl-2H-1-benzofuran-5-yl)-2,5-dihydropyridine (CID 126512302) is 4-(3,3-dimethyl-2H-1-benzofuran-5-yl)-2,5-dihydropyridine.
What is the SMILES notation for 4-(3,3-dimethyl-2H-1-benzofuran-5-yl)-2,5-dihydropyridine?
The canonical SMILES for 4-(3,3-dimethyl-2H-1-benzofuran-5-yl)-2,5-dihydropyridine is CC1(C)COc2ccc(C3=CCN=CC3)cc21.
What is the InChIKey of 4-(3,3-dimethyl-2H-1-benzofuran-5-yl)-2,5-dihydropyridine?
The InChIKey is RQGNHOOLHFDKCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO/c1-15(2)10-17-14-4-3-12(9-13(14)15)11-5-7-16-8-6-11/h3-5,8-9H,6-7,10H2,1-2H3.
What are the key properties of 4-(3,3-dimethyl-2H-1-benzofuran-5-yl)-2,5-dihydropyridine?
4-(3,3-dimethyl-2H-1-benzofuran-5-yl)-2,5-dihydropyridine has a molecular weight of 227.31 g/mol, XLogP of 3.21, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3-dimethyl-2H-1-benzofuran-5-yl)-2,5-dihydropyridine is sourced from PubChem (CID 126512302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).