C12H12N4OS2 — CID 126512570
2-amino-N-(5-methyl-2,3-dihydro-1,2-thiazol-4-yl)thieno[3,2-b]pyridine-3-carboxamide (PubChem CID 126512570) has the molecular formula C12H12N4OS2 and a molecular weight of 292.39 g/mol. Its IUPAC name is 2-amino-N-(5-methyl-2,3-dihydro-1,2-thiazol-4-yl)thieno[3,2-b]pyridine-3-carboxamide.
| Compound Name | 2-amino-N-(5-methyl-2,3-dihydro-1,2-thiazol-4-yl)thieno[3,2-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 126512570 |
| Molecular Formula | C12H12N4OS2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 2-amino-N-(5-methyl-2,3-dihydro-1,2-thiazol-4-yl)thieno[3,2-b]pyridine-3-carboxamide |
| SMILES | CC1=C(NC(=O)c2c(N)sc3cccnc23)CNS1 |
| InChI | InChI=1S/C12H12N4OS2/c1-6-7(5-15-19-6)16-12(17)9-10-8(18-11(9)13)3-2-4-14-10/h2-4,15H,5,13H2,1H3,(H,16,17) |
| InChIKey | DLHODUZVGSUAMD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|