C20H22ClF3N6O2 — CID 126512596
2-amino-N-[(1E,3E)-3-[(3S,5R)-3-amino-5-(trifluoromethyl)piperidin-1-yl]-1-(methylideneamino)penta-1,3-dien-2-yl]-6-chlorofuro[3,2-b]pyridine-3-carboxamide (PubChem CID 126512596) has the molecular formula C20H22ClF3N6O2 and a molecular weight of 470.88 g/mol. Its IUPAC name is 2-amino-N-[(1E,3E)-3-[(3S,5R)-3-amino-5-(trifluoromethyl)piperidin-1-yl]-1-(methylideneamino)penta-1,3-dien-2-yl]-6-chlorofuro[3,2-b]pyridine-3-carboxamide.
| Compound Name | 2-amino-N-[(1E,3E)-3-[(3S,5R)-3-amino-5-(trifluoromethyl)piperidin-1-yl]-1-(methylideneamino)penta-1,3-dien-2-yl]-6-chlorofuro[3,2-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 126512596 |
| Molecular Formula | C20H22ClF3N6O2 |
| Molecular Weight | 470.88 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 2-amino-N-[(1E,3E)-3-[(3S,5R)-3-amino-5-(trifluoromethyl)piperidin-1-yl]-1-(methylideneamino)penta-1,3-dien-2-yl]-6-chlorofuro[3,2-b]pyridine-3-carboxamide |
| SMILES | C=N/C=C(NC(=O)c1c(N)oc2cc(Cl)cnc12)\C(=C/C)N1C[C@@H](N)C[C@@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C20H22ClF3N6O2/c1-3-14(30-8-10(20(22,23)24)4-12(25)9-30)13(7-27-2)29-19(31)16-17-15(32-18(16)26)5-11(21)6-28-17/h3,5-7,10,12H,2,4,8-9,25-26H2,1H3,(H,29,31)/b13-7+,14-3+/t10-,12+/m1/s1 |
| InChIKey | UZTZVWSQOJJNTB-OWSRXMIYSA-N |
| XLogP | 3.45 |
| TPSA | 122.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.88 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|