About 3-methyl-5-[[2-methyl-4-(methylamino)phenyl]diazenyl]thiophene-2,4-dicarbonitrile
3-methyl-5-[[2-methyl-4-(methylamino)phenyl]diazenyl]thiophene-2,4-dicarbonitrile (PubChem CID 126512718) has the molecular formula C15H13N5S
and a molecular weight of 295.37 g/mol. Its IUPAC name is 3-methyl-5-[[2-methyl-4-(methylamino)phenyl]diazenyl]thiophene-2,4-dicarbonitrile.
Molecular Properties
| Compound Name | 3-methyl-5-[[2-methyl-4-(methylamino)phenyl]diazenyl]thiophene-2,4-dicarbonitrile |
| PubChem CID | 126512718 |
| Molecular Formula | C15H13N5S |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 3-methyl-5-[[2-methyl-4-(methylamino)phenyl]diazenyl]thiophene-2,4-dicarbonitrile |
| SMILES | CNc1ccc(/N=N/c2sc(C#N)c(C)c2C#N)c(C)c1 |
| InChI | InChI=1S/C15H13N5S/c1-9-6-11(18-3)4-5-13(9)19-20-15-12(7-16)10(2)14(8-17)21-15/h4-6,18H,1-3H3/b20-19+ |
| InChIKey | UWGOWPVLBXDRQJ-FMQUCBEESA-N |
| XLogP | 4.57 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-5-[[2-methyl-4-(methylamino)phenyl]diazenyl]thiophene-2,4-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-[[2-methyl-4-(methylamino)phenyl]diazenyl]thiophene-2,4-dicarbonitrile?
The IUPAC name of 3-methyl-5-[[2-methyl-4-(methylamino)phenyl]diazenyl]thiophene-2,4-dicarbonitrile (CID 126512718) is 3-methyl-5-[[2-methyl-4-(methylamino)phenyl]diazenyl]thiophene-2,4-dicarbonitrile.
What is the SMILES notation for 3-methyl-5-[[2-methyl-4-(methylamino)phenyl]diazenyl]thiophene-2,4-dicarbonitrile?
The canonical SMILES for 3-methyl-5-[[2-methyl-4-(methylamino)phenyl]diazenyl]thiophene-2,4-dicarbonitrile is CNc1ccc(/N=N/c2sc(C#N)c(C)c2C#N)c(C)c1.
What is the InChIKey of 3-methyl-5-[[2-methyl-4-(methylamino)phenyl]diazenyl]thiophene-2,4-dicarbonitrile?
The InChIKey is UWGOWPVLBXDRQJ-FMQUCBEESA-N. The full InChI is InChI=1S/C15H13N5S/c1-9-6-11(18-3)4-5-13(9)19-20-15-12(7-16)10(2)14(8-17)21-15/h4-6,18H,1-3H3/b20-19+.
What are the key properties of 3-methyl-5-[[2-methyl-4-(methylamino)phenyl]diazenyl]thiophene-2,4-dicarbonitrile?
3-methyl-5-[[2-methyl-4-(methylamino)phenyl]diazenyl]thiophene-2,4-dicarbonitrile has a molecular weight of 295.37 g/mol, XLogP of 4.57, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-[[2-methyl-4-(methylamino)phenyl]diazenyl]thiophene-2,4-dicarbonitrile is sourced from PubChem (CID 126512718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).