About N-[(3Z,5Z)-1-nitro-2-(2-phenyl-1H-indol-3-yl)hepta-3,5-dien-3-yl]methanimine
N-[(3Z,5Z)-1-nitro-2-(2-phenyl-1H-indol-3-yl)hepta-3,5-dien-3-yl]methanimine (PubChem CID 126512784) has the molecular formula C22H21N3O2
and a molecular weight of 359.43 g/mol. Its IUPAC name is N-[(3Z,5Z)-1-nitro-2-(2-phenyl-1H-indol-3-yl)hepta-3,5-dien-3-yl]methanimine.
Molecular Properties
| Compound Name | N-[(3Z,5Z)-1-nitro-2-(2-phenyl-1H-indol-3-yl)hepta-3,5-dien-3-yl]methanimine |
| PubChem CID | 126512784 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-[(3Z,5Z)-1-nitro-2-(2-phenyl-1H-indol-3-yl)hepta-3,5-dien-3-yl]methanimine |
| SMILES | C=N/C(=C\C=C/C)C(C[N+](=O)[O-])c1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C22H21N3O2/c1-3-4-13-19(23-2)18(15-25(26)27)21-17-12-8-9-14-20(17)24-22(21)16-10-6-5-7-11-16/h3-14,18,24H,2,15H2,1H3/b4-3-,19-13- |
| InChIKey | XUZOIBRUNKKZPR-WLAJIJDGSA-N |
| XLogP | 5.36 |
| TPSA | 71.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3Z,5Z)-1-nitro-2-(2-phenyl-1H-indol-3-yl)hepta-3,5-dien-3-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3Z,5Z)-1-nitro-2-(2-phenyl-1H-indol-3-yl)hepta-3,5-dien-3-yl]methanimine?
The IUPAC name of N-[(3Z,5Z)-1-nitro-2-(2-phenyl-1H-indol-3-yl)hepta-3,5-dien-3-yl]methanimine (CID 126512784) is N-[(3Z,5Z)-1-nitro-2-(2-phenyl-1H-indol-3-yl)hepta-3,5-dien-3-yl]methanimine.
What is the SMILES notation for N-[(3Z,5Z)-1-nitro-2-(2-phenyl-1H-indol-3-yl)hepta-3,5-dien-3-yl]methanimine?
The canonical SMILES for N-[(3Z,5Z)-1-nitro-2-(2-phenyl-1H-indol-3-yl)hepta-3,5-dien-3-yl]methanimine is C=N/C(=C\C=C/C)C(C[N+](=O)[O-])c1c(-c2ccccc2)[nH]c2ccccc12.
What is the InChIKey of N-[(3Z,5Z)-1-nitro-2-(2-phenyl-1H-indol-3-yl)hepta-3,5-dien-3-yl]methanimine?
The InChIKey is XUZOIBRUNKKZPR-WLAJIJDGSA-N. The full InChI is InChI=1S/C22H21N3O2/c1-3-4-13-19(23-2)18(15-25(26)27)21-17-12-8-9-14-20(17)24-22(21)16-10-6-5-7-11-16/h3-14,18,24H,2,15H2,1H3/b4-3-,19-13-.
What are the key properties of N-[(3Z,5Z)-1-nitro-2-(2-phenyl-1H-indol-3-yl)hepta-3,5-dien-3-yl]methanimine?
N-[(3Z,5Z)-1-nitro-2-(2-phenyl-1H-indol-3-yl)hepta-3,5-dien-3-yl]methanimine has a molecular weight of 359.43 g/mol, XLogP of 5.36, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3Z,5Z)-1-nitro-2-(2-phenyl-1H-indol-3-yl)hepta-3,5-dien-3-yl]methanimine is sourced from PubChem (CID 126512784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).