C18H23FN2O2 — CID 126512848
[2-fluoro-3-[4-[(2E,4Z)-5-(methylideneamino)penta-2,4-dien-2-yl]oxypiperidin-1-yl]phenyl]methanol (PubChem CID 126512848) has the molecular formula C18H23FN2O2 and a molecular weight of 318.39 g/mol. Its IUPAC name is [2-fluoro-3-[4-[(2E,4Z)-5-(methylideneamino)penta-2,4-dien-2-yl]oxypiperidin-1-yl]phenyl]methanol.
| Compound Name | [2-fluoro-3-[4-[(2E,4Z)-5-(methylideneamino)penta-2,4-dien-2-yl]oxypiperidin-1-yl]phenyl]methanol |
|---|---|
| PubChem CID | 126512848 |
| Molecular Formula | C18H23FN2O2 |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | [2-fluoro-3-[4-[(2E,4Z)-5-(methylideneamino)penta-2,4-dien-2-yl]oxypiperidin-1-yl]phenyl]methanol |
| SMILES | C=N/C=C\C=C(/C)OC1CCN(c2cccc(CO)c2F)CC1 |
| InChI | InChI=1S/C18H23FN2O2/c1-14(5-4-10-20-2)23-16-8-11-21(12-9-16)17-7-3-6-15(13-22)18(17)19/h3-7,10,16,22H,2,8-9,11-13H2,1H3/b10-4-,14-5+ |
| InChIKey | SLDHLWDVIHTYBR-SENWVQMDSA-N |
| XLogP | 3.42 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|