C19H39N — CID 126513346
2,2,4,4,7,7-hexamethyl-1,5-di(propan-2-yl)azocane (PubChem CID 126513346) has the molecular formula C19H39N and a molecular weight of 281.53 g/mol. Its IUPAC name is 2,2,4,4,7,7-hexamethyl-1,5-di(propan-2-yl)azocane.
| Compound Name | 2,2,4,4,7,7-hexamethyl-1,5-di(propan-2-yl)azocane |
|---|---|
| PubChem CID | 126513346 |
| Molecular Formula | C19H39N |
| Molecular Weight | 281.53 g/mol |
| Exact Mass | 281.31 |
| IUPAC Name | 2,2,4,4,7,7-hexamethyl-1,5-di(propan-2-yl)azocane |
| SMILES | CC(C)C1CC(C)(C)CN(C(C)C)C(C)(C)CC1(C)C |
| InChI | InChI=1S/C19H39N/c1-14(2)16-11-17(5,6)13-20(15(3)4)19(9,10)12-18(16,7)8/h14-16H,11-13H2,1-10H3 |
| InChIKey | XGSVAVOOOPPFCB-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.53 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |