C21H40N2O — CID 126513454
5-[(1R)-1-aminoethyl]-N-cyclodecylcyclooctane-1-carboxamide (PubChem CID 126513454) has the molecular formula C21H40N2O and a molecular weight of 336.56 g/mol. Its IUPAC name is 5-[(1R)-1-aminoethyl]-N-cyclodecylcyclooctane-1-carboxamide.
| Compound Name | 5-[(1R)-1-aminoethyl]-N-cyclodecylcyclooctane-1-carboxamide |
|---|---|
| PubChem CID | 126513454 |
| Molecular Formula | C21H40N2O |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.31 |
| IUPAC Name | 5-[(1R)-1-aminoethyl]-N-cyclodecylcyclooctane-1-carboxamide |
| SMILES | C[C@@H](N)C1CCCC(C(=O)NC2CCCCCCCCC2)CCC1 |
| InChI | InChI=1S/C21H40N2O/c1-17(22)18-11-9-13-19(14-10-12-18)21(24)23-20-15-7-5-3-2-4-6-8-16-20/h17-20H,2-16,22H2,1H3,(H,23,24)/t17-,18?,19?/m1/s1 |
| InChIKey | CMFBJYRWOYGIAE-LMDPOFIKSA-N |
| XLogP | 4.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |