C26H29N — CID 126513612
1-[4,7-bis[(1Z)-buta-1,3-dienyl]-1,9-bis(ethenyl)-3,6,8-trimethylspiro[4.4]nona-1,3,6,8-tetraen-2-yl]-N-methylmethanimine (PubChem CID 126513612) has the molecular formula C26H29N and a molecular weight of 355.53 g/mol. Its IUPAC name is 1-[4,7-bis[(1Z)-buta-1,3-dienyl]-1,9-bis(ethenyl)-3,6,8-trimethylspiro[4.4]nona-1,3,6,8-tetraen-2-yl]-N-methylmethanimine.
| Compound Name | 1-[4,7-bis[(1Z)-buta-1,3-dienyl]-1,9-bis(ethenyl)-3,6,8-trimethylspiro[4.4]nona-1,3,6,8-tetraen-2-yl]-N-methylmethanimine |
|---|---|
| PubChem CID | 126513612 |
| Molecular Formula | C26H29N |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 1-[4,7-bis[(1Z)-buta-1,3-dienyl]-1,9-bis(ethenyl)-3,6,8-trimethylspiro[4.4]nona-1,3,6,8-tetraen-2-yl]-N-methylmethanimine |
| SMILES | C=C/C=C\C1=C(C)C2(C(C=C)=C1C)C(C=C)=C(/C=N/C)C(C)=C2/C=C\C=C |
| InChI | InChI=1S/C26H29N/c1-9-13-15-21-18(5)23(11-3)26(20(21)7)24(12-4)22(17-27-8)19(6)25(26)16-14-10-2/h9-17H,1-4H2,5-8H3/b15-13-,16-14-,27-17+ |
| InChIKey | DEXQAANBHVTRQO-ITGSXOAUSA-N |
| XLogP | 6.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|